CAS 51938-10-4 is the registry number for 8-Hydroxychlorpromazine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol;hydrochloride (CAS 51938-10-4) is a chemical compound with the molecular formula C17H20Cl2N2OS and a molecular weight of 371.3 g/mol. IUPAC name: 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol;hydrochloride. InChIKey: FJEAGKRVYJSHKN-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2OS |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol;hydrochloride |
| InChIKey | FJEAGKRVYJSHKN-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=C(C=CC(=C2)O)SC3=C1C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)