CAS 51938-11-5 appears in our catalog under these names: 7-Hydroxy Chlorpromazine Hydrochloride, >95% (HPLC), 7–hydroxy Chlorpromazine (hydrochloride), 7-Hydroxychlorpromazine (hydrochloride). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 500 μg, 1 mg.
8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-3-ol;hydrochloride (CAS 51938-11-5) is a chemical compound with the molecular formula C17H20Cl2N2OS and a molecular weight of 371.3 g/mol. IUPAC name: 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-3-ol;hydrochloride. InChIKey: OTIORHLXOLCOAV-UHFFFAOYSA-N.
| Molecular formula | C17H20Cl2N2OS |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-3-ol;hydrochloride |
| InChIKey | OTIORHLXOLCOAV-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C2=C(C=C(C=C2)O)SC3=C1C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)