CAS 316121-89-8 appears in our catalog under these names: 2-Amino-4,6-dichlorobenzonitrile, 95+%, 2-Amino-4,6-dichlorobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-amino-4,6-dichlorobenzonitrile (CAS 316121-89-8) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 2-amino-4,6-dichlorobenzonitrile. InChIKey: GZAHHXLOLGSNND-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 2-amino-4,6-dichlorobenzonitrile |
| InChIKey | GZAHHXLOLGSNND-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)C#N)Cl)Cl |
Computed by PubChem (NCBI)