CAS 31659-42-4 appears in our catalog under these names: Imidocarb Impurity 2, 2-(3-Nitrophenyl)-4,5-dihydro-1H-imidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-(3-nitrophenyl)-4,5-dihydro-1H-imidazole (CAS 31659-42-4) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazole. InChIKey: YSCJJOXSVFNSPY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-4,5-dihydro-1H-imidazole |
| InChIKey | YSCJJOXSVFNSPY-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)