Products 31748-34-2
CAS 31748-34-2 is the registry number for 4-[1-(4-hydroxy-3-nitro-phenyl)cyclohexyl]-2-nitro-phenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
4-[1-(4-hydroxy-3-nitrophenyl)cyclohexyl]-2-nitrophenol (CAS 31748-34-2) is a chemical compound with the molecular formula C18H18N2O6 and a molecular weight of 358.3 g/mol. IUPAC name: 4-[1-(4-hydroxy-3-nitrophenyl)cyclohexyl]-2-nitrophenol. InChIKey: UCOJYNWKRMOOSY-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O6 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 4-[1-(4-hydroxy-3-nitrophenyl)cyclohexyl]-2-nitrophenol |
| InChIKey | UCOJYNWKRMOOSY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=C(C=C2)O)[N+](=O)[O-])C3=CC(=C(C=C3)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)