CAS 85677-94-7 is the registry number for Nimodipine Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid (CAS 85677-94-7) is a chemical compound with the molecular formula C18H18N2O6 and a molecular weight of 358.3 g/mol. IUPAC name: 2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid. InChIKey: QHTXAYAFRQRYOP-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O6 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid |
| InChIKey | QHTXAYAFRQRYOP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)