Products 85677-94-7

CAS 85677-94-7 is the registry number for Nimodipine Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid (CAS 85677-94-7) is a chemical compound with the molecular formula C18H18N2O6 and a molecular weight of 358.3 g/mol. IUPAC name: 2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid. InChIKey: QHTXAYAFRQRYOP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O6
Molecular weight358.3 g/mol
IUPAC name2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonylpyridine-3-carboxylic acid
InChIKeyQHTXAYAFRQRYOP-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)