Products 89267-41-4
CAS 89267-41-4 appears in our catalog under these names: Dehydro Nitrendipine, Nitrendipine Impurity 5, Dehydronitrendipine, >95% (HPLC), Ethyl Methyl 2,6-Dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (Photolysis Product), 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 89267-41-4) is a chemical compound with the molecular formula C18H18N2O6 and a molecular weight of 358.3 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: YEHVABIPGJLMET-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O6 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | YEHVABIPGJLMET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Bay-m 4786, Bay m 4786, Nitrendipine M (dehydro), Dehydronitrendipine, Nitrendipine EP Impurity A, 3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate, 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester, Nitrendipine impurity A, Nitrendipine impurity A CRS, YEHVABIPGJLMET-UHFFFAOYSA-N