CAS 31876-68-3 is the registry number for 4-Methoxy-1-methyl-5-nitro-1H-imidazole. Offered by: TRC. Available pack sizes: 500mg.
5-methoxy-1-methyl-4-nitroimidazole (CAS 31876-68-3) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 5-methoxy-1-methyl-4-nitroimidazole. InChIKey: XRILSOBTTUTXJM-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | 5-methoxy-1-methyl-4-nitroimidazole |
| InChIKey | XRILSOBTTUTXJM-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)