CAS 31877-68-6 appears in our catalog under these names: 4H-Chromeno[4,3-d][1,3]thiazol-2-amine, 95%, 4H-Chromeno(4,3-d)thiazol-2-ylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g, 50mg.
4H-chromeno[4,3-d][1,3]thiazol-2-amine (CAS 31877-68-6) is a chemical compound with the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. IUPAC name: 4H-chromeno[4,3-d][1,3]thiazol-2-amine. InChIKey: NVHFPWSBQGIUJA-UHFFFAOYSA-N.
| Molecular formula | C10H8N2OS |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 4H-chromeno[4,3-d][1,3]thiazol-2-amine |
| InChIKey | NVHFPWSBQGIUJA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3O1)N=C(S2)N |
Computed by PubChem (NCBI)