CAS 90842-21-0 is the registry number for N-Phenylthiazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-phenyl-1,3-thiazole-5-carboxamide (CAS 90842-21-0) is a chemical compound with the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. IUPAC name: N-phenyl-1,3-thiazole-5-carboxamide. InChIKey: KSWSCDXHZZVNAS-UHFFFAOYSA-N.
| Molecular formula | C10H8N2OS |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | N-phenyl-1,3-thiazole-5-carboxamide |
| InChIKey | KSWSCDXHZZVNAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CN=CS2 |
Computed by PubChem (NCBI)