CAS 863763-95-5 is the registry number for 3,7-Dimethyl-5-oxo-5h-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile (CAS 863763-95-5) is a chemical compound with the molecular formula C10H8N2OS and a molecular weight of 204.25 g/mol. IUPAC name: 3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile. InChIKey: YQLHSTADBBGTBK-UHFFFAOYSA-N.
| Molecular formula | C10H8N2OS |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 3,7-dimethyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
| InChIKey | YQLHSTADBBGTBK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=CSC2=C1C#N)C |
Computed by PubChem (NCBI)