Products 318996-98-4

CAS 318996-98-4 is the registry number for Fmoc-DL-Ser(Bzl)-OH 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid (CAS 318996-98-4) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid. InChIKey: DYBDGLCDMLNEMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC25H23NO5
Molecular weight417.5 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid
InChIKeyDYBDGLCDMLNEMJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COCC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)