CAS 83792-48-7 appears in our catalog under these names: Fmoc–Ser(Bzl)–OH, Fmoc-L-Ser(Bzl)-OH, Fmoc-O-benzyl-L-serine, Fmoc-Ser(Bzl)-OH, >95.0%(HPLC)(T), Fmoc-Ser(Bzl)-OH 95%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 10g, 50g, 250g, 100g, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid (CAS 83792-48-7) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid. InChIKey: DYBDGLCDMLNEMJ-QHCPKHFHSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylmethoxypropanoic acid |
| InChIKey | DYBDGLCDMLNEMJ-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)