CAS 39986-26-0 appears in our catalog under these names: Delta-9-Tetrahydrocannabivarinic Acid, Δ9-Tetrahydrocannabivarinic acid (THCVA) 100 µg/mL in Acetonitrile, Δ9-Tetrahydrocannabivarinic acid (THCVA) 1000 µg/mL in Acetonitrile, Tetrahydrocannabivarinic Acid (CRM), Delta-9-Tetrahydrocannabivarinic acid, Concentration: 10 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Dr. Ehrenstorfer, GLPBio, Biosynth, HPC Standards. Available pack sizes: on request, 1ml, 1mg, 2mg, 5mg, 1x1ml.
(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid (CAS 39986-26-0) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid. InChIKey: IQSYWEWTWDEVNO-ZIAGYGMSSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (6aR,10aR)-1-hydroxy-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylic acid |
| InChIKey | IQSYWEWTWDEVNO-ZIAGYGMSSA-N |
| SMILES | CCCC1=CC2=C([C@@H]3C=C(CC[C@H]3C(O2)(C)C)C)C(=C1C(=O)O)O |
Computed by PubChem (NCBI)