Products 320-58-1
CAS 320-58-1 appears in our catalog under these names: 2-Amino-2-(2-fluorophenyl)propanoic acid, 2-Amino-2-(2-fluorophenyl)propanoic acid, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 50mg.
2-amino-2-(2-fluorophenyl)propanoic acid (CAS 320-58-1) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 2-amino-2-(2-fluorophenyl)propanoic acid. InChIKey: IZYUJJJMQDWOSS-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 2-amino-2-(2-fluorophenyl)propanoic acid |
| InChIKey | IZYUJJJMQDWOSS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1F)(C(=O)O)N |
Computed by PubChem (NCBI)