Products 320423-22-1
CAS 320423-22-1 is the registry number for 2,3-Dimethylphenyl 1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
(2,3-dimethylphenyl) 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate (CAS 320423-22-1) is a chemical compound with the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. IUPAC name: (2,3-dimethylphenyl) 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate. InChIKey: YHQUJOJKXDJUIK-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2O2 |
|---|---|
| Molecular weight | 298.26 g/mol |
| IUPAC name | (2,3-dimethylphenyl) 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
| InChIKey | YHQUJOJKXDJUIK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC(=O)C2=CN(N=C2C(F)(F)F)C)C |
Computed by PubChem (NCBI)