CAS 3205-25-2 appears in our catalog under these names: 1–(2–Nitrophenyl)ethanol, 1-(2-Nitrophenyl)ethanol, 98%, rac-1-(2-Nitrophenyl)ethanol, 1-(2-Nitrophenyl)ethanol 97%, 1-(2-Nitrophenyl)ethanol, 95%. Offered by: GLPBio, Combi-blocks, TRC, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 500mg, 250mg, 100mg.
1-(2-nitrophenyl)ethanol (CAS 3205-25-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 1-(2-nitrophenyl)ethanol. InChIKey: DSDBYQDNNWCLHL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethanol |
| InChIKey | DSDBYQDNNWCLHL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)