Products 320777-05-7
CAS 320777-05-7 is the registry number for GLY-230. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(3-chloroanilino)phenyl]acetic acid (CAS 320777-05-7) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: 2-[2-(3-chloroanilino)phenyl]acetic acid. InChIKey: ZTFVCZLJMNRVHT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-[2-(3-chloroanilino)phenyl]acetic acid |
| InChIKey | ZTFVCZLJMNRVHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(3-chlorophenylamino)phenylacetic acid, 2-[3-chlorophenylamino]phenylacetic acid, 23CPPA cpd, 2-[(3-chlorophenyl)amino]phenylacetic acid, 2-[(3-Chlorophenyl)amino]benzeneacetic acid, ZTFVCZLJMNRVHT-UHFFFAOYSA-N, 2-[2-(3-chloroanilino)phenyl]acetic acid, 2-(2-((3-Chlorophenyl)amino)phenyl)acetic acid