CAS 320777-08-0 is the registry number for Diclofenac sodium Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-chloroanilino)phenyl]acetic acid (CAS 320777-08-0) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: 2-[2-(4-chloroanilino)phenyl]acetic acid. InChIKey: APTHDCOWRSJXLL-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-[2-(4-chloroanilino)phenyl]acetic acid |
| InChIKey | APTHDCOWRSJXLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)