CAS 321195-86-2 appears in our catalog under these names: 3-Chloro-4-methoxybenzohydrazide, 95%, 3-Chloro-4-methoxybenzohydrazide, 95+%, 3–Chloro–4–methoxybenzohydrazide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
3-chloro-4-methoxybenzohydrazide (CAS 321195-86-2) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 3-chloro-4-methoxybenzohydrazide. InChIKey: VDYLSICSZJSRCC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 3-chloro-4-methoxybenzohydrazide |
| InChIKey | VDYLSICSZJSRCC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NN)Cl |
Computed by PubChem (NCBI)