Products 32140-93-5
CAS 32140-93-5 is the registry number for 1,3-Bis(2,4-dimethoxyphenyl)propane-1,3-dione, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1,3-bis(2,4-dimethoxyphenyl)propane-1,3-dione (CAS 32140-93-5) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: 1,3-bis(2,4-dimethoxyphenyl)propane-1,3-dione. InChIKey: KWBFJDUJUZGKQY-UHFFFAOYSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 1,3-bis(2,4-dimethoxyphenyl)propane-1,3-dione |
| InChIKey | KWBFJDUJUZGKQY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)CC(=O)C2=C(C=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)