CAS 32142-24-8 is the registry number for 3,6-Dideoxy-L-arabino-hexose. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
Aldehydo-ascarylose is an aldehyde that is the acyclic form of ascarylose. It is an aldehyde and an ascarylose.
Source: ChEBI
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2R,4R,5S)-2,4,5-trihydroxyhexanal |
| InChIKey | GNTQICZXQYZQNE-KVQBGUIXSA-N |
| SMILES | C[C@@H]([C@@H](C[C@H](C=O)O)O)O |
Computed by PubChem (NCBI)