CAS 321574-26-9 is the registry number for (2r,6s)-12-bromo-3-methyl-4,8-dioxa-3-azatricyclo[7.4.0.0(2,6)]trideca-1(13),9,11-triene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3aS,9bR)-8-bromo-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole (CAS 321574-26-9) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: (3aS,9bR)-8-bromo-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole. InChIKey: IKMNZXXFKNSMLB-WRWORJQWSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | (3aS,9bR)-8-bromo-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
| InChIKey | IKMNZXXFKNSMLB-WRWORJQWSA-N |
| SMILES | CN1[C@@H]2[C@@H](COC3=C2C=C(C=C3)Br)CO1 |
Computed by PubChem (NCBI)