Products 32178-86-2
CAS 32178-86-2 appears in our catalog under these names: Cefazedone Impurity 17, Des-3,5-dichloro-4-pyridinone des-5-methyl-1,3,4-thiadiazole-2-thiol acetate Cefazedone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(6R,7R)-7-acetamido-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 32178-86-2) is a chemical compound with the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. IUPAC name: (6R,7R)-7-acetamido-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: XZWUXKVIZOHFTC-LDYMZIIASA-N.
| Molecular formula | C12H14N2O6S |
|---|---|
| Molecular weight | 314.32 g/mol |
| IUPAC name | (6R,7R)-7-acetamido-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | XZWUXKVIZOHFTC-LDYMZIIASA-N |
| SMILES | CC(=O)N[C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(=O)O |
Computed by PubChem (NCBI)