Products 1396962-98-3

CAS 1396962-98-3 is the registry number for 2-(4-Acetylbenzenesulfonamido)-3-carbamoylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(4-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid (CAS 1396962-98-3) is a chemical compound with the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. IUPAC name: 2-[(4-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid. InChIKey: QVGGIKOTVXGKEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O6S
Molecular weight314.32 g/mol
IUPAC name2-[(4-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid
InChIKeyQVGGIKOTVXGKEZ-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=C(C=C1)S(=O)(=O)NC(CC(=O)N)C(=O)O

Computed by PubChem (NCBI)