CAS 1384428-32-3 appears in our catalog under these names: Methyl 5-((dimethylcarbamoyl)sulfanyl)-4-methoxy-2-nitrobenzoate, 95%, Methyl 5-((dimethylcarbamoyl)sulfanyl)-4-methoxy-2-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 5-(dimethylcarbamoylsulfanyl)-4-methoxy-2-nitrobenzoate (CAS 1384428-32-3) is a chemical compound with the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. IUPAC name: methyl 5-(dimethylcarbamoylsulfanyl)-4-methoxy-2-nitrobenzoate. InChIKey: SDCGQAXAAIARJP-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6S |
|---|---|
| Molecular weight | 314.32 g/mol |
| IUPAC name | methyl 5-(dimethylcarbamoylsulfanyl)-4-methoxy-2-nitrobenzoate |
| InChIKey | SDCGQAXAAIARJP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)