Products 1262965-52-5
CAS 1262965-52-5 is the registry number for 2-(3-Acetylbenzenesulfonamido)-3-carbamoylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid (CAS 1262965-52-5) is a chemical compound with the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. IUPAC name: 2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid. InChIKey: OEXWAECXFKHOFE-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6S |
|---|---|
| Molecular weight | 314.32 g/mol |
| IUPAC name | 2-[(3-acetylphenyl)sulfonylamino]-4-amino-4-oxobutanoic acid |
| InChIKey | OEXWAECXFKHOFE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)S(=O)(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)