CAS 321939-51-9 is the registry number for 4,6-Dimethoxybenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dimethoxy-1-benzofuran (CAS 321939-51-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4,6-dimethoxy-1-benzofuran. InChIKey: KJQBVSLIHABWKY-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4,6-dimethoxy-1-benzofuran |
| InChIKey | KJQBVSLIHABWKY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CO2)C(=C1)OC |
Computed by PubChem (NCBI)