CAS 32222-45-0 appears in our catalog under these names: (2R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid, (R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid 97%, (R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid, 98%, 98%, (R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg, 1g, 100mg, 10g, 25g.
(2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid (CAS 32222-45-0) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid. InChIKey: RWCMOQXHIDWDDJ-SSDOTTSWSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | RWCMOQXHIDWDDJ-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)O)F |
Computed by PubChem (NCBI)