CAS 32222-46-1 is the registry number for (R)-Ethyl 2-(4-fluorophenyl)-2-hydroxyacetate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl (2R)-2-(4-fluorophenyl)-2-hydroxyacetate (CAS 32222-46-1) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: ethyl (2R)-2-(4-fluorophenyl)-2-hydroxyacetate. InChIKey: CNCGHQKCIUHNRW-SECBINFHSA-N.
| Molecular formula | C10H11FO3 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | ethyl (2R)-2-(4-fluorophenyl)-2-hydroxyacetate |
| InChIKey | CNCGHQKCIUHNRW-SECBINFHSA-N |
| SMILES | CCOC(=O)[C@@H](C1=CC=C(C=C1)F)O |
Computed by PubChem (NCBI)