CAS 32333-31-6 appears in our catalog under these names: 1–(2,2–Dimethylchroman–6–yl)ethanone, 1-(2,2-Dimethylchroman-6-yl)ethanone, 95%, 1-(2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-6-yl)ethan-1-one. Offered by: GLPBio, Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)ethanone (CAS 32333-31-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)ethanone. InChIKey: KNRXTFUVMPVXBK-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)ethanone |
| InChIKey | KNRXTFUVMPVXBK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC(CC2)(C)C |
Computed by PubChem (NCBI)