Products 32366-58-8
CAS 32366-58-8 appears in our catalog under these names: 2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid, 95%, 2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3-hydroxyphenyl)quinoline-4-carboxylic acid (CAS 32366-58-8) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 2-(3-hydroxyphenyl)quinoline-4-carboxylic acid. InChIKey: VECNLFVATDBRIW-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 2-(3-hydroxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | VECNLFVATDBRIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)O)C(=O)O |
Computed by PubChem (NCBI)