CAS 898759-95-0 appears in our catalog under these names: 2-(4-Phenoxybenzoyl)oxazole, 95%, 95%, 2-(4-Phenoxybenzoyl)oxazole, 95%, 2–(4–Phenoxybenzoyl)oxazole. Offered by: Chemat, Combi-blocks, Fluorochem, Ambeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
1,3-oxazol-2-yl-(4-phenoxyphenyl)methanone (CAS 898759-95-0) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 1,3-oxazol-2-yl-(4-phenoxyphenyl)methanone. InChIKey: SETVYQYNYUPHSL-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 1,3-oxazol-2-yl-(4-phenoxyphenyl)methanone |
| InChIKey | SETVYQYNYUPHSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C3=NC=CO3 |
Computed by PubChem (NCBI)