CAS 408527-91-3 appears in our catalog under these names: N-(2-Formylbenzyl)phthalimide, 95%, N-(2-Formylbenzyl)phthalimide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde (CAS 408527-91-3) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde. InChIKey: LPKRIOYQZNXMQZ-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde |
| InChIKey | LPKRIOYQZNXMQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=O)C3=CC=CC=C3C2=O)C=O |
Computed by PubChem (NCBI)