Products 32387-22-7
CAS 32387-22-7 appears in our catalog under these names: 5-Methoxy-2-methyl-1H-indole-3-carboxylic acid, 5-Methoxy-2-methyl-1H-indole-3-carboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
5-methoxy-2-methyl-1H-indole-3-carboxylic acid (CAS 32387-22-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 5-methoxy-2-methyl-1H-indole-3-carboxylic acid. InChIKey: ORUFFPUSVXGKCC-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 5-methoxy-2-methyl-1H-indole-3-carboxylic acid |
| InChIKey | ORUFFPUSVXGKCC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)