CAS 324020-70-4 is the registry number for 2-Acetyl-7-fluoronaphthalene. Offered by: TRC. Available pack sizes: 250mg.
1-(7-fluoronaphthalen-2-yl)ethanone (CAS 324020-70-4) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 1-(7-fluoronaphthalen-2-yl)ethanone. InChIKey: UXFZUFVOHYDZLR-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 1-(7-fluoronaphthalen-2-yl)ethanone |
| InChIKey | UXFZUFVOHYDZLR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=CC(=C2)F |
Computed by PubChem (NCBI)