CAS 5044-26-8 appears in our catalog under these names: 2,5-Dimethyl-1-(4-methylphenyl)-1H-pyrrole, 2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 2,5g, 1g.
2,5-dimethyl-1-(4-methylphenyl)pyrrole (CAS 5044-26-8) is a chemical compound with the molecular formula C13H15N and a molecular weight of 185.26 g/mol. IUPAC name: 2,5-dimethyl-1-(4-methylphenyl)pyrrole. InChIKey: SWIUPUUNVWDJED-UHFFFAOYSA-N.
| Molecular formula | C13H15N |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | 2,5-dimethyl-1-(4-methylphenyl)pyrrole |
| InChIKey | SWIUPUUNVWDJED-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC=C2C)C |
Computed by PubChem (NCBI)