Products 325691-41-6
CAS 325691-41-6 is the registry number for H-Ala-Gly-Tyr-NH2 acetate salt. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
(2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanamide (CAS 325691-41-6) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanamide. InChIKey: KZSBMVDYRVFKMV-KWQFWETISA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-2-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanamide |
| InChIKey | KZSBMVDYRVFKMV-KWQFWETISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N)N |
Computed by PubChem (NCBI)
Synonyms:
H-Ala-Gly-Tyr-NH2, H-Ala-Gly-Tyr-NH2 acetate salt