CAS 325763-68-6 is the registry number for Dimethyl 2-[(chloroacetyl)amino]terephthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dimethyl 2-[(2-chloroacetyl)amino]benzene-1,4-dicarboxylate (CAS 325763-68-6) is a chemical compound with the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. IUPAC name: dimethyl 2-[(2-chloroacetyl)amino]benzene-1,4-dicarboxylate. InChIKey: MCJXWDAWSRTYBH-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO5 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | dimethyl 2-[(2-chloroacetyl)amino]benzene-1,4-dicarboxylate |
| InChIKey | MCJXWDAWSRTYBH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)NC(=O)CCl |
Computed by PubChem (NCBI)