Products 57444-70-9
CAS 57444-70-9 appears in our catalog under these names: (4-chlorobenzoyl)-L-glutamic acid, (S)-2-(4-Chlorobenzamido)pentanedioic acid 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
2-[(4-chlorobenzoyl)amino]pentanedioic acid (CAS 57444-70-9) is a chemical compound with the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]pentanedioic acid. InChIKey: ZPXCXBRPCFSCHI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO5 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]pentanedioic acid |
| InChIKey | ZPXCXBRPCFSCHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)