CAS 717830-27-8 appears in our catalog under these names: 3-(5-Chloro-2,4-dimethoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 95%, 3-(5-Chloro-2,4-dimethoxyphenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-(5-chloro-2,4-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 717830-27-8) is a chemical compound with the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. IUPAC name: 3-(5-chloro-2,4-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: IDRVXUULWFWTEI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO5 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | 3-(5-chloro-2,4-dimethoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | IDRVXUULWFWTEI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=NOC(C2)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)