CAS 32578-12-4 is the registry number for 1-(3-Methoxyphenyl)-2,2-dimethylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-methoxyphenyl)-2,2-dimethylpropan-1-one (CAS 32578-12-4) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-one. InChIKey: IPTMKVLYPISCRA-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-2,2-dimethylpropan-1-one |
| InChIKey | IPTMKVLYPISCRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)