CAS 325850-26-8 is the registry number for ALXR-agonist-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea (CAS 325850-26-8) is a chemical compound with the molecular formula C18H17ClN4O2 and a molecular weight of 356.8 g/mol. IUPAC name: 1-(3-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea. InChIKey: LYGPQBMQOCCMSG-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN4O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea |
| InChIKey | LYGPQBMQOCCMSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=O)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)