CAS 59440-79-8 is the registry number for 1-(2,3-dimethyl-5-oxo-1-phenyl(3-pyrazolin-4-yl))-3-chlorophenylurea. Offered by: Biosynth. Available pack sizes: 10g, 25g.
1-(4-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea (CAS 59440-79-8) is a chemical compound with the molecular formula C18H17ClN4O2 and a molecular weight of 356.8 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea. InChIKey: SYMZTHSEBKAOLU-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN4O2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)urea |
| InChIKey | SYMZTHSEBKAOLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)