CAS 32595-59-8 appears in our catalog under these names: H–DL–β–(2–Thienyl)–DL–Ser–OH, 2-Amino-3-hydroxy-3-(thiophen-2-yl)propanoic acid, 98%, 98%, 2-Amino-3-hydroxy-3-(thiophen-2-yl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
2-amino-3-hydroxy-3-thiophen-2-ylpropanoic acid (CAS 32595-59-8) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: 2-amino-3-hydroxy-3-thiophen-2-ylpropanoic acid. InChIKey: GNUCLSFLDHLOBV-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 2-amino-3-hydroxy-3-thiophen-2-ylpropanoic acid |
| InChIKey | GNUCLSFLDHLOBV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C(C(=O)O)N)O |
Computed by PubChem (NCBI)