Products 459180-73-5
CAS 459180-73-5 is the registry number for Sulfasalazine Impurity 23. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-chloro-3-methyl-N-(6-methyl-2-pyridinyl)benzenesulfonamide (CAS 459180-73-5) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: 4-chloro-3-methyl-N-(6-methyl-2-pyridinyl)benzenesulfonamide. InChIKey: ZMLGUBIPNVPDQZ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | 4-chloro-3-methyl-N-(6-methyl-2-pyridinyl)benzenesulfonamide |
| InChIKey | ZMLGUBIPNVPDQZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C |
Computed by PubChem (NCBI)