CAS 32604-86-7 is the registry number for 4'-(N-Hydroxysulfanilyl)acetanilide. Offered by: TRC. Available pack sizes: 50mg, 5mg.
N-[4-[4-(hydroxyamino)phenyl]sulfonylphenyl]acetamide (CAS 32604-86-7) is a chemical compound with the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. IUPAC name: N-[4-[4-(hydroxyamino)phenyl]sulfonylphenyl]acetamide. InChIKey: YUWDJHZQRAHBBW-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | N-[4-[4-(hydroxyamino)phenyl]sulfonylphenyl]acetamide |
| InChIKey | YUWDJHZQRAHBBW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)NO |
Computed by PubChem (NCBI)