Products 792954-01-9
CAS 792954-01-9 appears in our catalog under these names: N-(4-Aminophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide, 95%, N-(4-Aminophenyl)-2,3-dihydrobenzo(b)(1,4)dioxine-6-sulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
N-(4-aminophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CAS 792954-01-9) is a chemical compound with the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. IUPAC name: N-(4-aminophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide. InChIKey: MRXWTLVVPGOSNX-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | N-(4-aminophenyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| InChIKey | MRXWTLVVPGOSNX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)