Products 857558-63-5
CAS 857558-63-5 is the registry number for 2-(4-((4-Aminophenyl)sulfonamido)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-[(4-aminophenyl)sulfonylamino]phenyl]acetic acid (CAS 857558-63-5) is a chemical compound with the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. IUPAC name: 2-[4-[(4-aminophenyl)sulfonylamino]phenyl]acetic acid. InChIKey: RRVFBDDHZGAKIE-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | 2-[4-[(4-aminophenyl)sulfonylamino]phenyl]acetic acid |
| InChIKey | RRVFBDDHZGAKIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)