Products 326182-57-4
CAS 326182-57-4 appears in our catalog under these names: 3-(Azepan-1-ylsulfonyl)benzoic acid, 96%, 3-(azepan-1-ylsulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3-(azepan-1-ylsulfonyl)benzoic acid (CAS 326182-57-4) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 3-(azepan-1-ylsulfonyl)benzoic acid. InChIKey: KDJJBORBRZBZPN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 3-(azepan-1-ylsulfonyl)benzoic acid |
| InChIKey | KDJJBORBRZBZPN-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)